CAS 904016-65-5 appears in our catalog under these names: 5-Amino-2-(4-fluorophenyl)-2,3-dihydro-1H-isoindole-1,3-dione, 95%, 5-Amino-2-(4-fluorophenyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-amino-2-(4-fluorophenyl)isoindole-1,3-dione (CAS 904016-65-5) is a chemical compound with the molecular formula C14H9FN2O2 and a molecular weight of 256.23 g/mol. IUPAC name: 5-amino-2-(4-fluorophenyl)isoindole-1,3-dione. InChIKey: KJJQQXNTFVPKAZ-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O2 |
|---|---|
| Molecular weight | 256.23 g/mol |
| IUPAC name | 5-amino-2-(4-fluorophenyl)isoindole-1,3-dione |
| InChIKey | KJJQQXNTFVPKAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)N)F |
Computed by PubChem (NCBI)