Products 904249-92-9
CAS 904249-92-9 is the registry number for 3,3'-((5-Pivalamidoisophthaloyl)bis(azanediyl))dibenzoic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
3-[[3-[(3-carboxyphenyl)carbamoyl]-5-(2,2-dimethylpropanoylamino)benzoyl]amino]benzoic acid (CAS 904249-92-9) is a chemical compound with the molecular formula C27H25N3O7 and a molecular weight of 503.5 g/mol. IUPAC name: 3-[[3-[(3-carboxyphenyl)carbamoyl]-5-(2,2-dimethylpropanoylamino)benzoyl]amino]benzoic acid. InChIKey: XWHACSKQDWORLP-UHFFFAOYSA-N.
| Molecular formula | C27H25N3O7 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | 3-[[3-[(3-carboxyphenyl)carbamoyl]-5-(2,2-dimethylpropanoylamino)benzoyl]amino]benzoic acid |
| InChIKey | XWHACSKQDWORLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC(=C1)C(=O)NC2=CC=CC(=C2)C(=O)O)C(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)