CAS 904309-12-2 is the registry number for DWP-05195. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-bromo-2-[5-[3-(trifluoromethyl)-2-pyridinyl]-2-pyridinyl]-1H-benzimidazole (CAS 904309-12-2) is a chemical compound with the molecular formula C18H10BrF3N4 and a molecular weight of 419.2 g/mol. IUPAC name: 6-bromo-2-[5-[3-(trifluoromethyl)-2-pyridinyl]-2-pyridinyl]-1H-benzimidazole. InChIKey: WGAVAOCYBMNWID-UHFFFAOYSA-N.
| Molecular formula | C18H10BrF3N4 |
|---|---|
| Molecular weight | 419.2 g/mol |
| IUPAC name | 6-bromo-2-[5-[3-(trifluoromethyl)-2-pyridinyl]-2-pyridinyl]-1H-benzimidazole |
| InChIKey | WGAVAOCYBMNWID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CN=C(C=C2)C3=NC4=C(N3)C=C(C=C4)Br)C(F)(F)F |
Computed by PubChem (NCBI)