Products 90445-02-6
CAS 90445-02-6 appears in our catalog under these names: Amlodipine Impurity 35, Amlodipine Impurity 20, p-Cl-Amlodipine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(4-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 90445-02-6) is a chemical compound with the molecular formula C20H25ClN2O5 and a molecular weight of 408.9 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(4-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: BZUCPNWDVIHOQI-UHFFFAOYSA-N.
| Molecular formula | C20H25ClN2O5 |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(4-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | BZUCPNWDVIHOQI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=C(C=C2)Cl)C(=O)OC)C)COCCN |
Computed by PubChem (NCBI)