CAS 904696-60-2 is the registry number for Lithium 2-(morpholinomethyl)benzoate, 95% . Offered by: Thermo Scientific. Available pack sizes: 1g.
Lithium 2-(morpholin-4-ylmethyl)benzoate (CAS 904696-60-2) is a chemical compound with the molecular formula C12H14LiNO3 and a molecular weight of 227.2 g/mol. IUPAC name: lithium 2-(morpholin-4-ylmethyl)benzoate. InChIKey: PKLIDBHLNQBFTO-UHFFFAOYSA-M.
| Molecular formula | C12H14LiNO3 |
|---|---|
| Molecular weight | 227.2 g/mol |
| IUPAC name | lithium 2-(morpholin-4-ylmethyl)benzoate |
| InChIKey | PKLIDBHLNQBFTO-UHFFFAOYSA-M |
| SMILES | [Li+].C1COCCN1CC2=CC=CC=C2C(=O)[O-] |
Computed by PubChem (NCBI)