Products 904755-29-9
CAS 904755-29-9 is the registry number for 4-(2-chlorophenyl)-1-(4-pyridylcarbonyl)semicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-(2-chlorophenyl)-3-(pyridine-4-carbonylamino)urea (CAS 904755-29-9) is a chemical compound with the molecular formula C13H11ClN4O2 and a molecular weight of 290.70 g/mol. IUPAC name: 1-(2-chlorophenyl)-3-(pyridine-4-carbonylamino)urea. InChIKey: FPYWBBWIAKZHMJ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4O2 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-3-(pyridine-4-carbonylamino)urea |
| InChIKey | FPYWBBWIAKZHMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NNC(=O)C2=CC=NC=C2)Cl |
Computed by PubChem (NCBI)