CAS 904803-58-3 is the registry number for AUPF02. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)urea (CAS 904803-58-3) is a chemical compound with the molecular formula C14H9F5N2O and a molecular weight of 316.23 g/mol. IUPAC name: 1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)urea. InChIKey: MXAYDAZDNCJWTF-UHFFFAOYSA-N.
| Molecular formula | C14H9F5N2O |
|---|---|
| Molecular weight | 316.23 g/mol |
| IUPAC name | 1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)urea |
| InChIKey | MXAYDAZDNCJWTF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)NC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)