Products 904815-29-8
CAS 904815-29-8 is the registry number for Anticancer agent 83. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[[5-methyl-1-(4-propan-2-ylphenyl)triazole-4-carbonyl]amino]phenyl] thiocyanate (CAS 904815-29-8) is a chemical compound with the molecular formula C20H19N5OS and a molecular weight of 377.5 g/mol. IUPAC name: [4-[[5-methyl-1-(4-propan-2-ylphenyl)triazole-4-carbonyl]amino]phenyl] thiocyanate. InChIKey: YVZLYBOOUTVSFY-UHFFFAOYSA-N.
| Molecular formula | C20H19N5OS |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | [4-[[5-methyl-1-(4-propan-2-ylphenyl)triazole-4-carbonyl]amino]phenyl] thiocyanate |
| InChIKey | YVZLYBOOUTVSFY-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)C(C)C)C(=O)NC3=CC=C(C=C3)SC#N |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 83, orb1688460