Products 905-62-4

CAS 905-62-4 is the registry number for 2,5-Di(naphthalen-1-yl)-1,3,4-oxadiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,5-dinaphthalen-1-yl-1,3,4-oxadiazole (CAS 905-62-4) is a chemical compound with the molecular formula C22H14N2O and a molecular weight of 322.4 g/mol. IUPAC name: 2,5-dinaphthalen-1-yl-1,3,4-oxadiazole. InChIKey: MUNFOTHAFHGRIM-UHFFFAOYSA-N.

Identity
Molecular formulaC22H14N2O
Molecular weight322.4 g/mol
IUPAC name2,5-dinaphthalen-1-yl-1,3,4-oxadiazole
InChIKeyMUNFOTHAFHGRIM-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2C3=NN=C(O3)C4=CC=CC5=CC=CC=C54

Computed by PubChem (NCBI)