CAS 905432-74-8 is the registry number for 1-(benzoyl)-4-(3-(trifluoromethyl)phenyl)semicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-benzamido-3-[3-(trifluoromethyl)phenyl]urea (CAS 905432-74-8) is a chemical compound with the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. IUPAC name: 1-benzamido-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: LOCHUWJMIWIGCV-UHFFFAOYSA-N.
| Molecular formula | C15H12F3N3O2 |
|---|---|
| Molecular weight | 323.27 g/mol |
| IUPAC name | 1-benzamido-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | LOCHUWJMIWIGCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NNC(=O)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)