CAS 905432-78-2 is the registry number for 1-(2-(4-fluorophenoxy)aceyl)-4-(3-(trifluoromethyl)phenyl)semicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(4-fluorophenoxy)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea (CAS 905432-78-2) is a chemical compound with the molecular formula C16H13F4N3O3 and a molecular weight of 371.29 g/mol. IUPAC name: 1-[[2-(4-fluorophenoxy)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: VTVXHEZJZLXZNZ-UHFFFAOYSA-N.
| Molecular formula | C16H13F4N3O3 |
|---|---|
| Molecular weight | 371.29 g/mol |
| IUPAC name | 1-[[2-(4-fluorophenoxy)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | VTVXHEZJZLXZNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)NNC(=O)COC2=CC=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)