Products 905677-04-5
CAS 905677-04-5 is the registry number for Antitubercular agent-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide (CAS 905677-04-5) is a chemical compound with the molecular formula C13H7BrN4O5 and a molecular weight of 379.12 g/mol. IUPAC name: N-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide. InChIKey: GIOGLLKLDCBYJX-UHFFFAOYSA-N.
| Molecular formula | C13H7BrN4O5 |
|---|---|
| Molecular weight | 379.12 g/mol |
| IUPAC name | N-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide |
| InChIKey | GIOGLLKLDCBYJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)NC(=O)C3=CC=C(O3)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)