CAS 905776-24-1 is the registry number for 4-(bis(6-hydroxy-4,4-dimethyl-2-oxocyclohex-1-enyl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]benzoic acid (CAS 905776-24-1) is a chemical compound with the molecular formula C24H28O6 and a molecular weight of 412.5 g/mol. IUPAC name: 4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]benzoic acid. InChIKey: RRJWPRLYLDEUSM-UHFFFAOYSA-N.
| Molecular formula | C24H28O6 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]benzoic acid |
| InChIKey | RRJWPRLYLDEUSM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C(C2=CC=C(C=C2)C(=O)O)C3=C(CC(CC3=O)(C)C)O)O)C |
Computed by PubChem (NCBI)