CAS 905920-49-2 appears in our catalog under these names: 3-Iodo-4-nitro-1,1'-biphenyl, 95%, 3-Iodo-4-nitro-1,1'-biphenyl, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 25g, 100g, 250g.
2-iodo-1-nitro-4-phenylbenzene (CAS 905920-49-2) is a chemical compound with the molecular formula C12H8INO2 and a molecular weight of 325.10 g/mol. IUPAC name: 2-iodo-1-nitro-4-phenylbenzene. InChIKey: MGMDLJUMWXFQFI-UHFFFAOYSA-N.
| Molecular formula | C12H8INO2 |
|---|---|
| Molecular weight | 325.10 g/mol |
| IUPAC name | 2-iodo-1-nitro-4-phenylbenzene |
| InChIKey | MGMDLJUMWXFQFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)[N+](=O)[O-])I |
Computed by PubChem (NCBI)