Products 90605-17-7

CAS 90605-17-7 is the registry number for Isodecyl Citrate. Offered by: TRC, Biosynth. Available pack sizes: 750mg, 1000mg, 500mg.

Structural formula: {0} (CAS {1})

2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid (CAS 90605-17-7) is a chemical compound with the molecular formula C16H28O7 and a molecular weight of 332.39 g/mol. IUPAC name: 2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid. InChIKey: BYZJEUMAMGGQNP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28O7
Molecular weight332.39 g/mol
IUPAC name2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid
InChIKeyBYZJEUMAMGGQNP-UHFFFAOYSA-N
SMILESCC(C)CCCCCCCOC(=O)CC(CC(=O)O)(C(=O)O)O

Computed by PubChem (NCBI)