CAS 906166-50-5 appears in our catalog under these names: 1-(4-Bromo-2-chlorophenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(4-Bromo-2-chlorophenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-(4-bromo-2-chlorophenyl)-2,5-dimethylpyrrole (CAS 906166-50-5) is a chemical compound with the molecular formula C12H11BrClN and a molecular weight of 284.58 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)-2,5-dimethylpyrrole. InChIKey: LQJKMZJVFBMUFZ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrClN |
|---|---|
| Molecular weight | 284.58 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)-2,5-dimethylpyrrole |
| InChIKey | LQJKMZJVFBMUFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=C(C=C2)Br)Cl)C |
Computed by PubChem (NCBI)