CAS 906327-16-0 appears in our catalog under these names: (S)-2-Formamido-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid, 95%, N-Formyl-3,5-diiodo-L-tyrosine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10g, 5g, 25g.
(2S)-2-formamido-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CAS 906327-16-0) is a chemical compound with the molecular formula C10H9I2NO4 and a molecular weight of 460.99 g/mol. IUPAC name: (2S)-2-formamido-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid. InChIKey: VHMVURRYXKQJID-QMMMGPOBSA-N.
| Molecular formula | C10H9I2NO4 |
|---|---|
| Molecular weight | 460.99 g/mol |
| IUPAC name | (2S)-2-formamido-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| InChIKey | VHMVURRYXKQJID-QMMMGPOBSA-N |
| SMILES | C1=C(C=C(C(=C1I)O)I)C[C@@H](C(=O)O)NC=O |
Computed by PubChem (NCBI)