CAS 906352-73-6 is the registry number for 2-(4-Isocyanatophenyl)-5-(trifluoromethyl)pyridine, 97+% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-(4-isocyanatophenyl)-5-(trifluoromethyl)pyridine (CAS 906352-73-6) is a chemical compound with the molecular formula C13H7F3N2O and a molecular weight of 264.20 g/mol. IUPAC name: 2-(4-isocyanatophenyl)-5-(trifluoromethyl)pyridine. InChIKey: GFEVPIXAPFROGH-UHFFFAOYSA-N.
| Molecular formula | C13H7F3N2O |
|---|---|
| Molecular weight | 264.20 g/mol |
| IUPAC name | 2-(4-isocyanatophenyl)-5-(trifluoromethyl)pyridine |
| InChIKey | GFEVPIXAPFROGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)C(F)(F)F)N=C=O |
Computed by PubChem (NCBI)