CAS 906453-86-9 is the registry number for (R)-3-Cyclopentyl-3-hydroxypropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-cyclopentyl-3-hydroxypropanoic acid (CAS 906453-86-9) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: (3R)-3-cyclopentyl-3-hydroxypropanoic acid. InChIKey: YMFXMBXXJUVSGH-SSDOTTSWSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | (3R)-3-cyclopentyl-3-hydroxypropanoic acid |
| InChIKey | YMFXMBXXJUVSGH-SSDOTTSWSA-N |
| SMILES | C1CCC(C1)[C@@H](CC(=O)O)O |
Computed by PubChem (NCBI)