Products 906522-88-1

CAS 906522-88-1 is the registry number for Lornoxicam Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 6-chloro-4-hydroxy-1,1-dioxo-2H-thieno[2,3-e]thiazine-3-carboxylate (CAS 906522-88-1) is a chemical compound with the molecular formula C8H6ClNO5S2 and a molecular weight of 295.7 g/mol. IUPAC name: methyl 6-chloro-4-hydroxy-1,1-dioxo-2H-thieno[2,3-e]thiazine-3-carboxylate. InChIKey: FWMLCQNJKRWJQC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO5S2
Molecular weight295.7 g/mol
IUPAC namemethyl 6-chloro-4-hydroxy-1,1-dioxo-2H-thieno[2,3-e]thiazine-3-carboxylate
InChIKeyFWMLCQNJKRWJQC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=C(C=C(S2)Cl)S(=O)(=O)N1)O

Computed by PubChem (NCBI)