CAS 906522-88-1 is the registry number for Lornoxicam Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-4-hydroxy-1,1-dioxo-2H-thieno[2,3-e]thiazine-3-carboxylate (CAS 906522-88-1) is a chemical compound with the molecular formula C8H6ClNO5S2 and a molecular weight of 295.7 g/mol. IUPAC name: methyl 6-chloro-4-hydroxy-1,1-dioxo-2H-thieno[2,3-e]thiazine-3-carboxylate. InChIKey: FWMLCQNJKRWJQC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5S2 |
|---|---|
| Molecular weight | 295.7 g/mol |
| IUPAC name | methyl 6-chloro-4-hydroxy-1,1-dioxo-2H-thieno[2,3-e]thiazine-3-carboxylate |
| InChIKey | FWMLCQNJKRWJQC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(C=C(S2)Cl)S(=O)(=O)N1)O |
Computed by PubChem (NCBI)