Products 906623-15-2

CAS 906623-15-2 is the registry number for 4-Bromo-3,5-diethylphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-bromo-3,5-diethylphenol (CAS 906623-15-2) is a chemical compound with the molecular formula C10H13BrO and a molecular weight of 229.11 g/mol. IUPAC name: 4-bromo-3,5-diethylphenol. InChIKey: QSFPEQVSTGLJFU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BrO
Molecular weight229.11 g/mol
IUPAC name4-bromo-3,5-diethylphenol
InChIKeyQSFPEQVSTGLJFU-UHFFFAOYSA-N
SMILESCCC1=CC(=CC(=C1Br)CC)O

Computed by PubChem (NCBI)