CAS 906775-63-1 is the registry number for 2-(2,5-Dichlorophenyl)-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(2,5-dichlorophenyl)-1H-indole (CAS 906775-63-1) is a chemical compound with the molecular formula C14H9Cl2N and a molecular weight of 262.1 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-1H-indole. InChIKey: XUSVEDVTSOVFDS-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2N |
|---|---|
| Molecular weight | 262.1 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-1H-indole |
| InChIKey | XUSVEDVTSOVFDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)