CAS 90685-58-8 appears in our catalog under these names: 2,3-Cyclopentenopyridine N-oxide, 98%, 6,7-Dihydro-5H-cyclopenta(b)pyridine 1-oxide, 98+%, 2,3-Cyclopentenopyridine N-oxide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.
1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium (CAS 90685-58-8) is a chemical compound with the molecular formula C8H9NO and a molecular weight of 135.16 g/mol. IUPAC name: 1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium. InChIKey: BSLCBYOXMDACSD-UHFFFAOYSA-N.
| Molecular formula | C8H9NO |
|---|---|
| Molecular weight | 135.16 g/mol |
| IUPAC name | 1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium |
| InChIKey | BSLCBYOXMDACSD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)[N+](=CC=C2)[O-] |
Computed by PubChem (NCBI)