Products 90691-33-1
CAS 90691-33-1 appears in our catalog under these names: Ethyl Acetate-d3, Ethyl Acetate-d3, 99 atom % D, min 98% Chemical Purity, Acetic–2，2，2–d3 acid，ethyl ester. Offered by: TRC, CDN, GLPBio. Available pack sizes: 250mg, 25mg, 1g, 5mg.
Ethyl 2,2,2-trideuterioacetate (CAS 90691-33-1) is a chemical compound with the molecular formula C4H8O2 and a molecular weight of 91.12 g/mol. IUPAC name: ethyl 2,2,2-trideuterioacetate. InChIKey: XEKOWRVHYACXOJ-BMSJAHLVSA-N.
| Molecular formula | C4H8O2 |
|---|---|
| Molecular weight | 91.12 g/mol |
| IUPAC name | ethyl 2,2,2-trideuterioacetate |
| InChIKey | XEKOWRVHYACXOJ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2,2,2-trideuterioacetate, ethyl (?H?)acetate