CAS 90734-72-8 appears in our catalog under these names: (6-Chloroimidazo(1,2-b)pyridazin-3-yl)(phenyl)methanone, 97%, (6–Chloroimidazo(1，2–b)pyridazin–3–yl)(phenyl)methanone. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 5g, 250mg.
(6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone (CAS 90734-72-8) is a chemical compound with the molecular formula C13H8ClN3O and a molecular weight of 257.67 g/mol. IUPAC name: (6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone. InChIKey: DWEXNPGMMTWOKC-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3O |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone |
| InChIKey | DWEXNPGMMTWOKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)