Products 90734-76-2
CAS 90734-76-2 appears in our catalog under these names: Imidazo[1,2-a]pyrazin-3-yl(phenyl)methanone, 95%, Imidazo(1，2–a)pyrazin–3–yl(phenyl)methanone, Imidazo[1,2-a]pyrazin-3-yl(phenyl)methanone 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
Imidazo[1,2-a]pyrazin-3-yl(phenyl)methanone (CAS 90734-76-2) is a chemical compound with the molecular formula C13H9N3O and a molecular weight of 223.23 g/mol. IUPAC name: imidazo[1,2-a]pyrazin-3-yl(phenyl)methanone. InChIKey: CVQCOFAEYRXAAP-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | imidazo[1,2-a]pyrazin-3-yl(phenyl)methanone |
| InChIKey | CVQCOFAEYRXAAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CN=C3N2C=CN=C3 |
Computed by PubChem (NCBI)