CAS 907545-49-7 is the registry number for Ethyl 4-(((tert-butyldimethylsilyl)oxy)methyl)-2-chlorothiazole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-1,3-thiazole-5-carboxylate (CAS 907545-49-7) is a chemical compound with the molecular formula C13H22ClNO3SSi and a molecular weight of 335.92 g/mol. IUPAC name: ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-1,3-thiazole-5-carboxylate. InChIKey: JPSAWXCHZMBGMJ-UHFFFAOYSA-N.
| Molecular formula | C13H22ClNO3SSi |
|---|---|
| Molecular weight | 335.92 g/mol |
| IUPAC name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-1,3-thiazole-5-carboxylate |
| InChIKey | JPSAWXCHZMBGMJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)Cl)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)