CAS 907572-24-1 is the registry number for (3S,4R)-tert-Butyl 4-(benzylamino)-3-fluoropiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl (3S,4R)-4-(benzylamino)-3-fluoropiperidine-1-carboxylate (CAS 907572-24-1) is a chemical compound with the molecular formula C17H25FN2O2 and a molecular weight of 308.4 g/mol. IUPAC name: tert-butyl (3S,4R)-4-(benzylamino)-3-fluoropiperidine-1-carboxylate. InChIKey: JXBLMDWEOQDVAC-LSDHHAIUSA-N.
| Molecular formula | C17H25FN2O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | tert-butyl (3S,4R)-4-(benzylamino)-3-fluoropiperidine-1-carboxylate |
| InChIKey | JXBLMDWEOQDVAC-LSDHHAIUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)