CAS 907604-62-0 is the registry number for POTASSIUM 5-FORMYLFURAN-2-YLTRIFLUOROBORATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
Potassium trifluoro-(5-formylfuran-2-yl)boranuide (CAS 907604-62-0) is a chemical compound with the molecular formula C5H3BF3KO2 and a molecular weight of 201.98 g/mol. IUPAC name: potassium trifluoro-(5-formylfuran-2-yl)boranuide. InChIKey: MFZQTPHWWAMAMF-UHFFFAOYSA-N.
| Molecular formula | C5H3BF3KO2 |
|---|---|
| Molecular weight | 201.98 g/mol |
| IUPAC name | potassium trifluoro-(5-formylfuran-2-yl)boranuide |
| InChIKey | MFZQTPHWWAMAMF-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(O1)C=O)(F)(F)F.[K+] |
Computed by PubChem (NCBI)