Products 907609-06-7
CAS 907609-06-7 appears in our catalog under these names: 2-fluoro-6-(2,2,2-trifluoroethoxy)benzaldehyde, 95%, 2-Fluoro-6-(2,2,2-trifluoroethoxy)-benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-fluoro-6-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 907609-06-7) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-fluoro-6-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: QNQWATWCTLTYSE-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-fluoro-6-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | QNQWATWCTLTYSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C=O)OCC(F)(F)F |
Computed by PubChem (NCBI)