Products 90784-86-4
CAS 90784-86-4 appears in our catalog under these names: M-Peg6-2-methylacrylate, 95%, m-PEG6-2-methylacrylate, 99%, m-PEG6-2-methylacrylate, m–PEG6–2–methylacrylate, m-PEG6-2-methylacrylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5mg, 10mg, 25mg, 250 mg.
2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (CAS 90784-86-4) is a chemical compound with the molecular formula C17H32O8 and a molecular weight of 364.4 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate. InChIKey: FVSGBTSAXJGUNZ-UHFFFAOYSA-N.
| Molecular formula | C17H32O8 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| InChIKey | FVSGBTSAXJGUNZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOCCOCCOCCOCCOCCOC |
Computed by PubChem (NCBI)