CAS 90799-56-7 appears in our catalog under these names: 7-Chloro-5-methylquinolin-8-ol, 96%, 5-Methyl-7-chloro-8-hydroxy-quinoline. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 2,5g.
7-chloro-5-methylquinolin-8-ol (CAS 90799-56-7) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 7-chloro-5-methylquinolin-8-ol. InChIKey: ZIOISVUUZNUJNX-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 7-chloro-5-methylquinolin-8-ol |
| InChIKey | ZIOISVUUZNUJNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C=CC=N2)O)Cl |
Computed by PubChem (NCBI)