CAS 90812-21-8 appears in our catalog under these names: 3-Chloro-1-aminoadamantane hydrochloride, 95%, 3-Chloroadamantan-1-amine hydrochloride, 95+%, 3-Chloro-1-aminoadamantane hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 5g, 1000mg, 500mg, 2000mg, 5000mg.
3-chloroadamantan-1-amine;hydrochloride (CAS 90812-21-8) is a chemical compound with the molecular formula C10H17Cl2N and a molecular weight of 222.15 g/mol. IUPAC name: 3-chloroadamantan-1-amine;hydrochloride. InChIKey: BRXNXSCWHSVIPC-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 3-chloroadamantan-1-amine;hydrochloride |
| InChIKey | BRXNXSCWHSVIPC-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)Cl)N.Cl |
Computed by PubChem (NCBI)