CAS 90821-99-1 appears in our catalog under these names: Cyclo(Ile-Ala), Cyclo(Ile-Ala)/ 99.88% (existing batch purity), Cyclo(Ile–Ala), Cyclo(Ile-Ala) (Standard), Cyclo(Ile-Ala), 98.47%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 0,5g.
3-butan-2-yl-6-methylpiperazine-2,5-dione (CAS 90821-99-1) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: 3-butan-2-yl-6-methylpiperazine-2,5-dione. InChIKey: JDRIJDPCYNFZIT-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 3-butan-2-yl-6-methylpiperazine-2,5-dione |
| InChIKey | JDRIJDPCYNFZIT-UHFFFAOYSA-N |
| SMILES | CCC(C)C1C(=O)NC(C(=O)N1)C |
Computed by PubChem (NCBI)