Products 90823-38-4
CAS 90823-38-4 appears in our catalog under these names: Denatonium Saccharide, Denatonium Saccharide, >98.0%(HPLC)(T), Denatonium saccharide 98%, Denatonium saccharide, 98%, 98%. Offered by: TRC, TCI, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100g, 500g.
Benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium;1,1-dioxo-1,2-benzothiazol-3-olate (CAS 90823-38-4) is a chemical compound with the molecular formula C28H33N3O4S and a molecular weight of 507.6 g/mol. IUPAC name: benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium;1,1-dioxo-1,2-benzothiazol-3-olate. InChIKey: AOVWCKBXCSVODH-UHFFFAOYSA-N.
| Molecular formula | C28H33N3O4S |
|---|---|
| Molecular weight | 507.6 g/mol |
| IUPAC name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium;1,1-dioxo-1,2-benzothiazol-3-olate |
| InChIKey | AOVWCKBXCSVODH-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.C1=CC=C2C(=C1)C(=NS2(=O)=O)[O-] |
Computed by PubChem (NCBI)