Products 908245-26-1
CAS 908245-26-1 is the registry number for 1,3-Diazidoadamantane. Offered by: TRC. Available pack sizes: 2,5g.
1,3-diazidoadamantane (CAS 908245-26-1) is a chemical compound with the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. IUPAC name: 1,3-diazidoadamantane. InChIKey: VYTTZRCUSZBQTC-UHFFFAOYSA-N.
| Molecular formula | C10H14N6 |
|---|---|
| Molecular weight | 218.26 g/mol |
| IUPAC name | 1,3-diazidoadamantane |
| InChIKey | VYTTZRCUSZBQTC-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N=[N+]=[N-])N=[N+]=[N-] |
Computed by PubChem (NCBI)