CAS 908269-77-2 appears in our catalog under these names: 1-(3-Aminophenyl)-2,2-dimethylpropan-1-one, 95%, 1-(3-Aminophenyl)-2,2-dimethylpropan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3-aminophenyl)-2,2-dimethylpropan-1-one (CAS 908269-77-2) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 1-(3-aminophenyl)-2,2-dimethylpropan-1-one. InChIKey: XYYUQEZTLWDZPH-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 1-(3-aminophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | XYYUQEZTLWDZPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC(=CC=C1)N |
Computed by PubChem (NCBI)