CAS 90852-19-0 is the registry number for BIS(N-DIAZO)-TRIS(O-ACETYL)-2-DEOXYSTREP. Offered by: Sigma-Aldrich. Available pack sizes: 250MG.
[(1R,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl] acetate (CAS 90852-19-0) is a chemical compound with the molecular formula C12H16N6O6 and a molecular weight of 340.29 g/mol. IUPAC name: [(1R,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl] acetate. InChIKey: SQKWPVVWVBKSIG-ZLERWKPPSA-N.
| Molecular formula | C12H16N6O6 |
|---|---|
| Molecular weight | 340.29 g/mol |
| IUPAC name | [(1R,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl] acetate |
| InChIKey | SQKWPVVWVBKSIG-ZLERWKPPSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](C[C@@H]([C@H](C1OC(=O)C)OC(=O)C)N=[N+]=[N-])N=[N+]=[N-] |
Computed by PubChem (NCBI)