Products 908570-13-8
CAS 908570-13-8 appears in our catalog under these names: PDE7–IN–3, PDE7-IN-3, 99.94%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50 mg, 10mM/1mL, 5 mg, 25 mg.
3-(8-chloro-2-oxospiro[1,3-dihydroquinazoline-4,1'-cyclohexane]-5-yl)oxycyclobutane-1-carboxylic acid (CAS 908570-13-8) is a chemical compound with the molecular formula C18H21ClN2O4 and a molecular weight of 364.8 g/mol. IUPAC name: 3-(8-chloro-2-oxospiro[1,3-dihydroquinazoline-4,1'-cyclohexane]-5-yl)oxycyclobutane-1-carboxylic acid. InChIKey: PFDYHSOOBQTYLZ-UHFFFAOYSA-N.
| Molecular formula | C18H21ClN2O4 |
|---|---|
| Molecular weight | 364.8 g/mol |
| IUPAC name | 3-(8-chloro-2-oxospiro[1,3-dihydroquinazoline-4,1'-cyclohexane]-5-yl)oxycyclobutane-1-carboxylic acid |
| InChIKey | PFDYHSOOBQTYLZ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C3=C(C=CC(=C3NC(=O)N2)Cl)OC4CC(C4)C(=O)O |
Computed by PubChem (NCBI)