CAS 908600-86-2 is the registry number for 5-Fluoro-1-triisopropylsilyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
(5-fluoroindol-1-yl)-tri(propan-2-yl)silane (CAS 908600-86-2) is a chemical compound with the molecular formula C17H26FNSi and a molecular weight of 291.5 g/mol. IUPAC name: (5-fluoroindol-1-yl)-tri(propan-2-yl)silane. InChIKey: ACHZLWIUAPEAHI-UHFFFAOYSA-N.
| Molecular formula | C17H26FNSi |
|---|---|
| Molecular weight | 291.5 g/mol |
| IUPAC name | (5-fluoroindol-1-yl)-tri(propan-2-yl)silane |
| InChIKey | ACHZLWIUAPEAHI-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C1C=CC(=C2)F |
Computed by PubChem (NCBI)