CAS 90868-14-7 is the registry number for Acetylcysteine Impurity 39. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(Z)-2-amino-3-phenylprop-2-enamide (CAS 90868-14-7) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: (Z)-2-amino-3-phenylprop-2-enamide. InChIKey: IWOMDZIDXYDQND-VURMDHGXSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | (Z)-2-amino-3-phenylprop-2-enamide |
| InChIKey | IWOMDZIDXYDQND-VURMDHGXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C(=O)N)\N |
Computed by PubChem (NCBI)