CAS 90877-03-5 is the registry number for 4-(Chloromethyl)-2-(2,6-dichlorophenyl)-1,3-thiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(chloromethyl)-2-(2,6-dichlorophenyl)-1,3-thiazole (CAS 90877-03-5) is a chemical compound with the molecular formula C10H6Cl3NS and a molecular weight of 278.6 g/mol. IUPAC name: 4-(chloromethyl)-2-(2,6-dichlorophenyl)-1,3-thiazole. InChIKey: FZLRHDRKBPZOJQ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3NS |
|---|---|
| Molecular weight | 278.6 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2,6-dichlorophenyl)-1,3-thiazole |
| InChIKey | FZLRHDRKBPZOJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NC(=CS2)CCl)Cl |
Computed by PubChem (NCBI)