CAS 90878-19-6 appears in our catalog under these names: Phenethylmagnesium chloride, 1M solution in THF, AcroSeal®, PHENETHYLMAGNESIUM CHLORIDE, 1.0M &. Offered by: Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ML, 800ML.
Magnesium;ethylbenzene;chloride (CAS 90878-19-6) is a chemical compound with the molecular formula C8H9ClMg and a molecular weight of 164.91 g/mol. IUPAC name: magnesium;ethylbenzene;chloride. InChIKey: OUTILEHLSPAZIN-UHFFFAOYSA-M.
| Molecular formula | C8H9ClMg |
|---|---|
| Molecular weight | 164.91 g/mol |
| IUPAC name | magnesium;ethylbenzene;chloride |
| InChIKey | OUTILEHLSPAZIN-UHFFFAOYSA-M |
| SMILES | [CH2-]CC1=CC=CC=C1.[Mg+2].[Cl-] |
Computed by PubChem (NCBI)