Products 90891-71-7
CAS 90891-71-7 is the registry number for 2-(2,2-Dimethylpropanamido)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(2,2-dimethylpropanoylamino)-3-methylbutanoic acid (CAS 90891-71-7) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-3-methylbutanoic acid. InChIKey: OXLOTCJAYCHDBD-UHFFFAOYSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-3-methylbutanoic acid |
| InChIKey | OXLOTCJAYCHDBD-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)