CAS 909103-23-7 appears in our catalog under these names: (2-Methyl-5-phenylthiophen-3-yl)boronic acid, 95%, 95%, (2-Methyl-5-phenylthiophen-3-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g.
(2-methyl-5-phenylthiophen-3-yl)boronic acid (CAS 909103-23-7) is a chemical compound with the molecular formula C11H11BO2S and a molecular weight of 218.08 g/mol. IUPAC name: (2-methyl-5-phenylthiophen-3-yl)boronic acid. InChIKey: VGHQIYVIUIHYBL-UHFFFAOYSA-N.
| Molecular formula | C11H11BO2S |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | (2-methyl-5-phenylthiophen-3-yl)boronic acid |
| InChIKey | VGHQIYVIUIHYBL-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC(=C1)C2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)