Products 909130-48-9
CAS 909130-48-9 is the registry number for 2-(Benzofuran-3-yl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-benzofuran-3-yl)indene-1,3-dione (CAS 909130-48-9) is a chemical compound with the molecular formula C17H10O3 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(1-benzofuran-3-yl)indene-1,3-dione. InChIKey: ITZAIGKXOAHYIW-UHFFFAOYSA-N.
| Molecular formula | C17H10O3 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-(1-benzofuran-3-yl)indene-1,3-dione |
| InChIKey | ITZAIGKXOAHYIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)C3=COC4=CC=CC=C43 |
Computed by PubChem (NCBI)