Products 909135-28-0
CAS 909135-28-0 appears in our catalog under these names: 3-Benzyl-3-methyl-7-oxo-3-azonia-bicyclo[3.3.1]nonane bromide, 95%, 3-Benzyl-3-azabicyclo(3.3.1)nonan-7-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-benzyl-3-methyl-3-azoniabicyclo[3.3.1]nonan-7-one bromide (CAS 909135-28-0) is a chemical compound with the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. IUPAC name: 3-benzyl-3-methyl-3-azoniabicyclo[3.3.1]nonan-7-one bromide. InChIKey: WQOFMIUINIVIEG-UHFFFAOYSA-M.
| Molecular formula | C16H22BrNO |
|---|---|
| Molecular weight | 324.26 g/mol |
| IUPAC name | 3-benzyl-3-methyl-3-azoniabicyclo[3.3.1]nonan-7-one bromide |
| InChIKey | WQOFMIUINIVIEG-UHFFFAOYSA-M |
| SMILES | C[N+]1(CC2CC(C1)CC(=O)C2)CC3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)