CAS 909187-40-2 appears in our catalog under these names: B-[6-(Dimethylamino)-2-fluoro-3-pyridinyl]-boronic acid, 95%, (2–Fluoro–6–(methylamino)pyridin–3–yl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g.
[2-fluoro-6-(methylamino)-3-pyridinyl]boronic acid (CAS 909187-40-2) is a chemical compound with the molecular formula C6H8BFN2O2 and a molecular weight of 169.95 g/mol. IUPAC name: [2-fluoro-6-(methylamino)-3-pyridinyl]boronic acid. InChIKey: RMOLRKYVAVBWTO-UHFFFAOYSA-N.
| Molecular formula | C6H8BFN2O2 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [2-fluoro-6-(methylamino)-3-pyridinyl]boronic acid |
| InChIKey | RMOLRKYVAVBWTO-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)NC)F)(O)O |
Computed by PubChem (NCBI)