Products 909245-93-8
CAS 909245-93-8 appears in our catalog under these names: 2-(1-Adamantyl)-5-(chloromethyl)-1,3,4-oxadiazole, 95%, 2-(Adamantan-1-yl)-5-(chloromethyl)-1,3,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(1-adamantyl)-5-(chloromethyl)-1,3,4-oxadiazole (CAS 909245-93-8) is a chemical compound with the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. IUPAC name: 2-(1-adamantyl)-5-(chloromethyl)-1,3,4-oxadiazole. InChIKey: CPWRCOVGLFMNRD-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O |
|---|---|
| Molecular weight | 252.74 g/mol |
| IUPAC name | 2-(1-adamantyl)-5-(chloromethyl)-1,3,4-oxadiazole |
| InChIKey | CPWRCOVGLFMNRD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=NN=C(O4)CCl |
Computed by PubChem (NCBI)