CAS 909272-14-6 appears in our catalog under these names: Ergothioneine Impurity 8, 2-Mercapto-L-histidine S-Carboxylic Acid Ethyl Ester Dihydrochloride. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[5-[(2S)-2-amino-3-ethoxy-3-oxopropyl]-1H-imidazol-2-yl]sulfanylformic acid;dihydrochloride (CAS 909272-14-6) is a chemical compound with the molecular formula C9H15Cl2N3O4S and a molecular weight of 332.20 g/mol. IUPAC name: [5-[(2S)-2-amino-3-ethoxy-3-oxopropyl]-1H-imidazol-2-yl]sulfanylformic acid;dihydrochloride. InChIKey: QFOCUSRQUOARKV-ILKKLZGPSA-N.
| Molecular formula | C9H15Cl2N3O4S |
|---|---|
| Molecular weight | 332.20 g/mol |
| IUPAC name | [5-[(2S)-2-amino-3-ethoxy-3-oxopropyl]-1H-imidazol-2-yl]sulfanylformic acid;dihydrochloride |
| InChIKey | QFOCUSRQUOARKV-ILKKLZGPSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CN=C(N1)SC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)